C18H25N4OS+ — CID 8600526
N-(2,5-dimethylphenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide (PubChem CID 8600526) has the molecular formula C18H25N4OS+ and a molecular weight of 345.49 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(2,5-dimethylphenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 8600526 |
| Molecular Formula | C18H25N4OS+ |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-[(5-methyl-1,2-oxazol-3-yl)methyl]piperazin-4-ium-1-carbothioamide |
| SMILES | Cc1ccc(C)c(NC(=S)N2CC[NH+](Cc3cc(C)on3)CC2)c1 |
| InChI | InChI=1S/C18H24N4OS/c1-13-4-5-14(2)17(10-13)19-18(24)22-8-6-21(7-9-22)12-16-11-15(3)23-20-16/h4-5,10-11H,6-9,12H2,1-3H3,(H,19,24)/p+1 |
| InChIKey | VYGPXTYHYIXQSQ-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 45.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|