C17H17F2N3O2S2 — CID 8745175
N-(2-fluorophenyl)-4-(4-fluorophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 8745175) has the molecular formula C17H17F2N3O2S2 and a molecular weight of 397.47 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-(4-fluorophenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-(2-fluorophenyl)-4-(4-fluorophenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8745175 |
| Molecular Formula | C17H17F2N3O2S2 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-(2-fluorophenyl)-4-(4-fluorophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCN(C(=S)Nc2ccccc2F)CC1 |
| InChI | InChI=1S/C17H17F2N3O2S2/c18-13-5-7-14(8-6-13)26(23,24)22-11-9-21(10-12-22)17(25)20-16-4-2-1-3-15(16)19/h1-8H,9-12H2,(H,20,25) |
| InChIKey | IRAKCIQPCCTOFG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|