C19H22FN3O2S2 — CID 8681199
N-(2,5-dimethylphenyl)-4-(3-fluorophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 8681199) has the molecular formula C19H22FN3O2S2 and a molecular weight of 407.54 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-(3-fluorophenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-(2,5-dimethylphenyl)-4-(3-fluorophenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8681199 |
| Molecular Formula | C19H22FN3O2S2 |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-(3-fluorophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | Cc1ccc(C)c(NC(=S)N2CCN(S(=O)(=O)c3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C19H22FN3O2S2/c1-14-6-7-15(2)18(12-14)21-19(26)22-8-10-23(11-9-22)27(24,25)17-5-3-4-16(20)13-17/h3-7,12-13H,8-11H2,1-2H3,(H,21,26) |
| InChIKey | XUQJJUAADJUYPQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|