C21H25N3O2S2 — CID 3345657
N-(2,5-dimethylphenyl)-4-(2-phenylethenylsulfonyl)piperazine-1-carbothioamide (PubChem CID 3345657) has the molecular formula C21H25N3O2S2 and a molecular weight of 415.58 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-(2-phenylethenylsulfonyl)piperazine-1-carbothioamide.
| Compound Name | N-(2,5-dimethylphenyl)-4-(2-phenylethenylsulfonyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3345657 |
| Molecular Formula | C21H25N3O2S2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-(2-phenylethenylsulfonyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(C)c(NC(=S)N2CCN(S(=O)(=O)C=Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H25N3O2S2/c1-17-8-9-18(2)20(16-17)22-21(27)23-11-13-24(14-12-23)28(25,26)15-10-19-6-4-3-5-7-19/h3-10,15-16H,11-14H2,1-2H3,(H,22,27) |
| InChIKey | NQCJOGVJMNWJJE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|