C13H18FN3O2S2 — CID 8770222
N-ethyl-4-(3-fluorophenyl)sulfonylpiperazine-1-carbothioamide (PubChem CID 8770222) has the molecular formula C13H18FN3O2S2 and a molecular weight of 331.44 g/mol. Its IUPAC name is N-ethyl-4-(3-fluorophenyl)sulfonylpiperazine-1-carbothioamide.
| Compound Name | N-ethyl-4-(3-fluorophenyl)sulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8770222 |
| Molecular Formula | C13H18FN3O2S2 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-ethyl-4-(3-fluorophenyl)sulfonylpiperazine-1-carbothioamide |
| SMILES | CCNC(=S)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C13H18FN3O2S2/c1-2-15-13(20)16-6-8-17(9-7-16)21(18,19)12-5-3-4-11(14)10-12/h3-5,10H,2,6-9H2,1H3,(H,15,20) |
| InChIKey | VASLUZMRKXRQEV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|