C13H20N4O3S — CID 61127355
4-(3-aminophenyl)sulfonyl-N-ethylpiperazine-1-carboxamide (PubChem CID 61127355) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 4-(3-aminophenyl)sulfonyl-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-(3-aminophenyl)sulfonyl-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 61127355 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-(3-aminophenyl)sulfonyl-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(S(=O)(=O)c2cccc(N)c2)CC1 |
| InChI | InChI=1S/C13H20N4O3S/c1-2-15-13(18)16-6-8-17(9-7-16)21(19,20)12-5-3-4-11(14)10-12/h3-5,10H,2,6-9,14H2,1H3,(H,15,18) |
| InChIKey | SVOOOPPTXDBJDH-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|