C14H17FN2O3S — CID 9369520
(E)-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]but-2-en-1-one (PubChem CID 9369520) has the molecular formula C14H17FN2O3S and a molecular weight of 312.37 g/mol. Its IUPAC name is (E)-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]but-2-en-1-one.
| Compound Name | (E)-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 9369520 |
| Molecular Formula | C14H17FN2O3S |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (E)-1-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C14H17FN2O3S/c1-2-4-14(18)16-7-9-17(10-8-16)21(19,20)13-6-3-5-12(15)11-13/h2-6,11H,7-10H2,1H3/b4-2+ |
| InChIKey | KLTKWYQPELFCCK-DUXPYHPUSA-N |
| XLogP | 1.23 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|