C16H26N3S+ — CID 2225306
4-(2-phenylethyl)-N-propylpiperazin-4-ium-1-carbothioamide (PubChem CID 2225306) has the molecular formula C16H26N3S+ and a molecular weight of 292.47 g/mol. Its IUPAC name is 4-(2-phenylethyl)-N-propylpiperazin-4-ium-1-carbothioamide.
| Compound Name | 4-(2-phenylethyl)-N-propylpiperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 2225306 |
| Molecular Formula | C16H26N3S+ |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-(2-phenylethyl)-N-propylpiperazin-4-ium-1-carbothioamide |
| SMILES | CCCNC(=S)N1CC[NH+](CCc2ccccc2)CC1 |
| InChI | InChI=1S/C16H25N3S/c1-2-9-17-16(20)19-13-11-18(12-14-19)10-8-15-6-4-3-5-7-15/h3-7H,2,8-14H2,1H3,(H,17,20)/p+1 |
| InChIKey | JVOMLOLMFXVAJY-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|