C21H28N3OS+ — CID 8561224
N-(3,4-dimethylphenyl)-4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide (PubChem CID 8561224) has the molecular formula C21H28N3OS+ and a molecular weight of 370.54 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 8561224 |
| Molecular Formula | C21H28N3OS+ |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-[(4-methoxyphenyl)methyl]piperazin-4-ium-1-carbothioamide |
| SMILES | COc1ccc(C[NH+]2CCN(C(=S)Nc3ccc(C)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C21H27N3OS/c1-16-4-7-19(14-17(16)2)22-21(26)24-12-10-23(11-13-24)15-18-5-8-20(25-3)9-6-18/h4-9,14H,10-13,15H2,1-3H3,(H,22,26)/p+1 |
| InChIKey | BOLVIPVKFCMQJV-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|