C21H33N4O2S+ — CID 9240451
4-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-methoxyphenyl)piperazin-4-ium-1-carbothioamide (PubChem CID 9240451) has the molecular formula C21H33N4O2S+ and a molecular weight of 405.59 g/mol. Its IUPAC name is 4-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-methoxyphenyl)piperazin-4-ium-1-carbothioamide.
| Compound Name | 4-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-methoxyphenyl)piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 9240451 |
| Molecular Formula | C21H33N4O2S+ |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 4-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-methoxyphenyl)piperazin-4-ium-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CC[NH+](CC(=O)N3C[C@@H](C)C[C@H](C)C3)CC2)cc1 |
| InChI | InChI=1S/C21H32N4O2S/c1-16-12-17(2)14-25(13-16)20(26)15-23-8-10-24(11-9-23)21(28)22-18-4-6-19(27-3)7-5-18/h4-7,16-17H,8-15H2,1-3H3,(H,22,28)/p+1/t16-,17-/m0/s1 |
| InChIKey | YWLQAOWMGPXZAU-IRXDYDNUSA-O |
| XLogP | 1.10 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|