C20H29ClN4OS — CID 9240326
N-(4-chlorophenyl)-4-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]piperazine-1-carbothioamide (PubChem CID 9240326) has the molecular formula C20H29ClN4OS and a molecular weight of 409.00 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]piperazine-1-carbothioamide.
| Compound Name | N-(4-chlorophenyl)-4-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 9240326 |
| Molecular Formula | C20H29ClN4OS |
| Molecular Weight | 409.00 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-(4-chlorophenyl)-4-[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]piperazine-1-carbothioamide |
| SMILES | C[C@H]1C[C@H](C)CN(C(=O)CN2CCN(C(=S)Nc3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C20H29ClN4OS/c1-15-11-16(2)13-25(12-15)19(26)14-23-7-9-24(10-8-23)20(27)22-18-5-3-17(21)4-6-18/h3-6,15-16H,7-14H2,1-2H3,(H,22,27)/t15-,16-/m0/s1 |
| InChIKey | XDUWGQDNGJRBHC-HOTGVXAUSA-N |
| XLogP | 3.16 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.00 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|