C20H30N5O3S+ — CID 9240704
4-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-nitrophenyl)piperazin-4-ium-1-carbothioamide (PubChem CID 9240704) has the molecular formula C20H30N5O3S+ and a molecular weight of 420.56 g/mol. Its IUPAC name is 4-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-nitrophenyl)piperazin-4-ium-1-carbothioamide.
| Compound Name | 4-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-nitrophenyl)piperazin-4-ium-1-carbothioamide |
|---|---|
| PubChem CID | 9240704 |
| Molecular Formula | C20H30N5O3S+ |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-(4-nitrophenyl)piperazin-4-ium-1-carbothioamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)C[NH+]2CCN(C(=S)Nc3ccc([N+](=O)[O-])cc3)CC2)C1 |
| InChI | InChI=1S/C20H29N5O3S/c1-15-11-16(2)13-24(12-15)19(26)14-22-7-9-23(10-8-22)20(29)21-17-3-5-18(6-4-17)25(27)28/h3-6,15-16H,7-14H2,1-2H3,(H,21,29)/p+1/t15-,16-/m1/s1 |
| InChIKey | ZRFUTSFOVTYNJS-HZPDHXFCSA-O |
| XLogP | 1.00 |
| TPSA | 83.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|