C20H28ClN4O4+ — CID 9246963
2-[4-(2-chloro-4-nitrobenzoyl)piperazin-1-ium-1-yl]-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethanone (PubChem CID 9246963) has the molecular formula C20H28ClN4O4+ and a molecular weight of 423.92 g/mol. Its IUPAC name is 2-[4-(2-chloro-4-nitrobenzoyl)piperazin-1-ium-1-yl]-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethanone.
| Compound Name | 2-[4-(2-chloro-4-nitrobenzoyl)piperazin-1-ium-1-yl]-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 9246963 |
| Molecular Formula | C20H28ClN4O4+ |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[4-(2-chloro-4-nitrobenzoyl)piperazin-1-ium-1-yl]-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]ethanone |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)C[NH+]2CCN(C(=O)c3ccc([N+](=O)[O-])cc3Cl)CC2)C1 |
| InChI | InChI=1S/C20H27ClN4O4/c1-14-9-15(2)12-24(11-14)19(26)13-22-5-7-23(8-6-22)20(27)17-4-3-16(25(28)29)10-18(17)21/h3-4,10,14-15H,5-9,11-13H2,1-2H3/p+1/t14-,15-/m1/s1 |
| InChIKey | AAWQFLZRYZCNPO-HUUCEWRRSA-O |
| XLogP | 1.09 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|