C21H31FN4OS — CID 9240761
4-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide (PubChem CID 9240761) has the molecular formula C21H31FN4OS and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | 4-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 9240761 |
| Molecular Formula | C21H31FN4OS |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 4-[2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl]-N-[(4-fluorophenyl)methyl]piperazine-1-carbothioamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(C(=O)CN2CCN(C(=S)NCc3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C21H31FN4OS/c1-16-11-17(2)14-26(13-16)20(27)15-24-7-9-25(10-8-24)21(28)23-12-18-3-5-19(22)6-4-18/h3-6,16-17H,7-15H2,1-2H3,(H,23,28)/t16-,17-/m1/s1 |
| InChIKey | WURAMKNIJFXUKR-IAGOWNOFSA-N |
| XLogP | 2.32 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|