C17H25FN2S — CID 44756385
N-[(4-fluorophenyl)methyl]-3,3,5-trimethylazepane-1-carbothioamide (PubChem CID 44756385) has the molecular formula C17H25FN2S and a molecular weight of 308.47 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3,3,5-trimethylazepane-1-carbothioamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3,3,5-trimethylazepane-1-carbothioamide |
|---|---|
| PubChem CID | 44756385 |
| Molecular Formula | C17H25FN2S |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3,3,5-trimethylazepane-1-carbothioamide |
| SMILES | CC1CCN(C(=S)NCc2ccc(F)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H25FN2S/c1-13-8-9-20(12-17(2,3)10-13)16(21)19-11-14-4-6-15(18)7-5-14/h4-7,13H,8-12H2,1-3H3,(H,19,21) |
| InChIKey | ILWKXYNHXDIEBJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|