C25H30ClN3O2S — CID 3863422
2-[2-(4-chlorophenyl)propanoyl]-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide (PubChem CID 3863422) has the molecular formula C25H30ClN3O2S and a molecular weight of 472.05 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)propanoyl]-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | 2-[2-(4-chlorophenyl)propanoyl]-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 3863422 |
| Molecular Formula | C25H30ClN3O2S |
| Molecular Weight | 472.05 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[2-(4-chlorophenyl)propanoyl]-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide |
| SMILES | COc1cccc(NC(=S)N2CCC3(CCN(C(=O)C(C)c4ccc(Cl)cc4)C3)CC2)c1 |
| InChI | InChI=1S/C25H30ClN3O2S/c1-18(19-6-8-20(26)9-7-19)23(30)29-15-12-25(17-29)10-13-28(14-11-25)24(32)27-21-4-3-5-22(16-21)31-2/h3-9,16,18H,10-15,17H2,1-2H3,(H,27,32) |
| InChIKey | ZHYJWCLGYOLKCX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.05 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|