C54H115O16P7S14 — CID 122658927
methyl 3-[bis[1-[bis[1-[bis(2-methylpropoxy)phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propanoate (PubChem CID 122658927) has the molecular formula C54H115O16P7S14 and a molecular weight of 1686.25 g/mol. Its IUPAC name is methyl 3-[bis[1-[bis[1-[bis(2-methylpropoxy)phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propanoate.
| Compound Name | methyl 3-[bis[1-[bis[1-[bis(2-methylpropoxy)phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propanoate |
|---|---|
| PubChem CID | 122658927 |
| Molecular Formula | C54H115O16P7S14 |
| Molecular Weight | 1686.25 g/mol |
| Exact Mass | 1684.24 |
| IUPAC Name | methyl 3-[bis[1-[bis[1-[bis(2-methylpropoxy)phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propanoate |
| SMILES | COC(=O)CCSP(=S)(OC(C)CSP(=S)(OC(C)CSP(=S)(OCC(C)C)OCC(C)C)OC(C)CSP(=S)(OCC(C)C)OCC(C)C)OC(C)CSP(=S)(OC(C)CSP(=S)(OCC(C)C)OCC(C)C)OC(C)CSP(=S)(OCC(C)C)OCC(C)C |
| InChI | InChI=1S/C54H115O16P7S14/c1-40(2)26-57-71(78,58-27-41(3)4)86-34-48(17)67-76(83,68-49(18)35-87-72(79,59-28-42(5)6)60-29-43(7)8)90-38-52(21)65-75(82,85-25-24-54(55)56-23)66-53(22)39-91-77(84,69-50(19)36-88-73(80,61-30-44(9)10)62-31-45(11)12)70-51(20)37-89-74(81,63-32-46(13)14)64-33-47(15)16/h40-53H,24-39H2,1-23H3 |
| InChIKey | XOIVZRZIVGQCQD-UHFFFAOYSA-N |
| XLogP | 22.06 |
| TPSA | 155.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 30 |
| Rotatable Bonds | 58 |
| Heavy Atoms | 91 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1686.25 |
| LogP ≤ 5 | 22.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 30 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|