C8H22NO3PS — CID 171480655
azanium bis(2-methylpropoxy)-oxido-sulfanylidene-λ5-phosphane (PubChem CID 171480655) has the molecular formula C8H22NO3PS and a molecular weight of 243.31 g/mol. Its IUPAC name is azanium bis(2-methylpropoxy)-oxido-sulfanylidene-λ5-phosphane.
| Compound Name | azanium bis(2-methylpropoxy)-oxido-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 171480655 |
| Molecular Formula | C8H22NO3PS |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | azanium bis(2-methylpropoxy)-oxido-sulfanylidene-λ5-phosphane |
| SMILES | CC(C)COP([O-])(=S)OCC(C)C.[NH4+] |
| InChI | InChI=1S/C8H19O3PS.H3N/c1-7(2)5-10-12(9,13)11-6-8(3)4;/h7-8H,5-6H2,1-4H3,(H,9,13);1H3 |
| InChIKey | WVXMHKLTUIYGRP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|