About methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane
methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane (PubChem CID 158113780) has the molecular formula C14H33O3P
and a molecular weight of 280.39 g/mol. Its IUPAC name is methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane.
Molecular Properties
| Compound Name | methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane |
| PubChem CID | 158113780 |
| Molecular Formula | C14H33O3P |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane |
| SMILES | C.C=P(OCC(C)C)(OCC(C)C)OCC(C)C |
| InChI | InChI=1S/C13H29O3P.CH4/c1-11(2)8-14-17(7,15-9-12(3)4)16-10-13(5)6;/h11-13H,7-10H2,1-6H3;1H4 |
| InChIKey | FQTHLHNGFNUATL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane?
The IUPAC name of methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane (CID 158113780) is methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane.
What is the SMILES notation for methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane?
The canonical SMILES for methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane is C.C=P(OCC(C)C)(OCC(C)C)OCC(C)C.
What is the InChIKey of methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane?
The InChIKey is FQTHLHNGFNUATL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29O3P.CH4/c1-11(2)8-14-17(7,15-9-12(3)4)16-10-13(5)6;/h11-13H,7-10H2,1-6H3;1H4.
What are the key properties of methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane?
methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane has a molecular weight of 280.39 g/mol, XLogP of 4.83, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methylidene-tris(2-methylpropoxy)-λ5-phosphane is sourced from PubChem (CID 158113780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).