C50H109O21P7S7 — CID 153452705
bis[1-[bis[1-[bis(2-methylpropoxy)phosphorylsulfanyl]propan-2-yloxy]phosphorylsulfanyl]propan-2-yloxy]-hydroxy-sulfanylidene-λ5-phosphane (PubChem CID 153452705) has the molecular formula C50H109O21P7S7 and a molecular weight of 1487.69 g/mol. Its IUPAC name is bis[1-[bis[1-[bis(2-methylpropoxy)phosphorylsulfanyl]propan-2-yloxy]phosphorylsulfanyl]propan-2-yloxy]-hydroxy-sulfanylidene-λ5-phosphane.
| Compound Name | bis[1-[bis[1-[bis(2-methylpropoxy)phosphorylsulfanyl]propan-2-yloxy]phosphorylsulfanyl]propan-2-yloxy]-hydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 153452705 |
| Molecular Formula | C50H109O21P7S7 |
| Molecular Weight | 1487.69 g/mol |
| Exact Mass | 1486.37 |
| IUPAC Name | bis[1-[bis[1-[bis(2-methylpropoxy)phosphorylsulfanyl]propan-2-yloxy]phosphorylsulfanyl]propan-2-yloxy]-hydroxy-sulfanylidene-λ5-phosphane |
| SMILES | CC(C)COP(=O)(OCC(C)C)SCC(C)OP(=O)(OC(C)CSP(=O)(OCC(C)C)OCC(C)C)SCC(C)OP(O)(=S)OC(C)CSP(=O)(OC(C)CSP(=O)(OCC(C)C)OCC(C)C)OC(C)CSP(=O)(OCC(C)C)OCC(C)C |
| InChI | InChI=1S/C50H109O21P7S7/c1-37(2)23-58-73(52,59-24-38(3)4)80-33-47(19)68-77(56,69-48(20)34-81-74(53,60-25-39(5)6)61-26-40(7)8)84-31-45(17)66-72(51,79)67-46(18)32-85-78(57,70-49(21)35-82-75(54,62-27-41(9)10)63-28-42(11)12)71-50(22)36-83-76(55,64-29-43(13)14)65-30-44(15)16/h37-50H,23-36H2,1-22H3,(H,51,79) |
| InChIKey | YKVWWKFGTOHQEP-UHFFFAOYSA-N |
| XLogP | 20.06 |
| TPSA | 251.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 27 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1487.69 |
| LogP ≤ 5 | 20.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 27 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|