C31H67O8P3S4 — CID 121277546
bis[1-[bis(4-methylpentan-2-yloxy)phosphinothioylsulfanyl]propan-2-yl] methyl phosphate (PubChem CID 121277546) has the molecular formula C31H67O8P3S4 and a molecular weight of 789.06 g/mol. Its IUPAC name is bis[1-[bis(4-methylpentan-2-yloxy)phosphinothioylsulfanyl]propan-2-yl] methyl phosphate.
| Compound Name | bis[1-[bis(4-methylpentan-2-yloxy)phosphinothioylsulfanyl]propan-2-yl] methyl phosphate |
|---|---|
| PubChem CID | 121277546 |
| Molecular Formula | C31H67O8P3S4 |
| Molecular Weight | 789.06 g/mol |
| Exact Mass | 788.29 |
| IUPAC Name | bis[1-[bis(4-methylpentan-2-yloxy)phosphinothioylsulfanyl]propan-2-yl] methyl phosphate |
| SMILES | COP(=O)(OC(C)CSP(=S)(OC(C)CC(C)C)OC(C)CC(C)C)OC(C)CSP(=S)(OC(C)CC(C)C)OC(C)CC(C)C |
| InChI | InChI=1S/C31H67O8P3S4/c1-22(2)16-26(9)36-41(43,37-27(10)17-23(3)4)45-20-30(13)34-40(32,33-15)35-31(14)21-46-42(44,38-28(11)18-24(5)6)39-29(12)19-25(7)8/h22-31H,16-21H2,1-15H3 |
| InChIKey | AKXBAZBYDWCADL-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.06 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|