C12H30NO2PS2 — CID 163360675
azanium bis(4-methylpentan-2-yloxy)-sulfanylidene-sulfido-λ5-phosphane (PubChem CID 163360675) has the molecular formula C12H30NO2PS2 and a molecular weight of 315.49 g/mol. Its IUPAC name is azanium bis(4-methylpentan-2-yloxy)-sulfanylidene-sulfido-λ5-phosphane.
| Compound Name | azanium bis(4-methylpentan-2-yloxy)-sulfanylidene-sulfido-λ5-phosphane |
|---|---|
| PubChem CID | 163360675 |
| Molecular Formula | C12H30NO2PS2 |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | azanium bis(4-methylpentan-2-yloxy)-sulfanylidene-sulfido-λ5-phosphane |
| SMILES | CC(C)CC(C)OP(=S)([S-])OC(C)CC(C)C.[NH4+] |
| InChI | InChI=1S/C12H27O2PS2.H3N/c1-9(2)7-11(5)13-15(16,17)14-12(6)8-10(3)4;/h9-12H,7-8H2,1-6H3,(H,16,17);1H3 |
| InChIKey | RZHZLFKZQUUAHX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 54.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|