C45H97O16P7S14 — CID 122658943
3-[bis[1-[bis[1-di(propan-2-yloxy)phosphinothioylsulfanylpropan-2-yloxy]phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propanoic acid (PubChem CID 122658943) has the molecular formula C45H97O16P7S14 and a molecular weight of 1560.01 g/mol. Its IUPAC name is 3-[bis[1-[bis[1-di(propan-2-yloxy)phosphinothioylsulfanylpropan-2-yloxy]phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propanoic acid.
| Compound Name | 3-[bis[1-[bis[1-di(propan-2-yloxy)phosphinothioylsulfanylpropan-2-yloxy]phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 122658943 |
| Molecular Formula | C45H97O16P7S14 |
| Molecular Weight | 1560.01 g/mol |
| Exact Mass | 1558.10 |
| IUPAC Name | 3-[bis[1-[bis[1-di(propan-2-yloxy)phosphinothioylsulfanylpropan-2-yloxy]phosphinothioylsulfanyl]propan-2-yloxy]phosphinothioylsulfanyl]propanoic acid |
| SMILES | CC(C)OP(=S)(OC(C)C)SCC(C)OP(=S)(OC(C)CSP(=S)(OC(C)C)OC(C)C)SCC(C)OP(=S)(OC(C)CSP(=S)(OC(C)CSP(=S)(OC(C)C)OC(C)C)OC(C)CSP(=S)(OC(C)C)OC(C)C)SCCC(=O)O |
| InChI | InChI=1S/C45H97O16P7S14/c1-31(2)48-62(69,49-32(3)4)77-25-41(19)58-67(74,59-42(20)26-78-63(70,50-33(5)6)51-34(7)8)81-29-39(17)56-66(73,76-24-23-45(46)47)57-40(18)30-82-68(75,60-43(21)27-79-64(71,52-35(9)10)53-36(11)12)61-44(22)28-80-65(72,54-37(13)14)55-38(15)16/h31-44H,23-30H2,1-22H3,(H,46,47) |
| InChIKey | UWMYDERYTLMEKN-UHFFFAOYSA-N |
| XLogP | 20.00 |
| TPSA | 166.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 29 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1560.01 |
| LogP ≤ 5 | 20.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 29 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|