C8H22AlO2PS2 — CID 175017596
alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane (PubChem CID 175017596) has the molecular formula C8H22AlO2PS2 and a molecular weight of 272.35 g/mol. Its IUPAC name is alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane.
| Compound Name | alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 175017596 |
| Molecular Formula | C8H22AlO2PS2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane |
| SMILES | CC(C)COP(O)(=S)SCC(C)C.[AlH3] |
| InChI | InChI=1S/C8H19O2PS2.Al.3H/c1-7(2)5-10-11(9,12)13-6-8(3)4;;;;/h7-8H,5-6H2,1-4H3,(H,9,12);;;; |
| InChIKey | FEMJPKNQKPJZHH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|