About alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane
alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane (PubChem CID 175017596) has the molecular formula C8H22AlO2PS2
and a molecular weight of 272.35 g/mol. Its IUPAC name is alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane |
| PubChem CID | 175017596 |
| Molecular Formula | C8H22AlO2PS2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane |
| SMILES | CC(C)COP(O)(=S)SCC(C)C.[AlH3] |
| InChI | InChI=1S/C8H19O2PS2.Al.3H/c1-7(2)5-10-11(9,12)13-6-8(3)4;;;;/h7-8H,5-6H2,1-4H3,(H,9,12);;;; |
| InChIKey | FEMJPKNQKPJZHH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane?
The IUPAC name of alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane (CID 175017596) is alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane.
What is the SMILES notation for alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane?
The canonical SMILES for alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane is CC(C)COP(O)(=S)SCC(C)C.[AlH3].
What is the InChIKey of alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane?
The InChIKey is FEMJPKNQKPJZHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19O2PS2.Al.3H/c1-7(2)5-10-11(9,12)13-6-8(3)4;;;;/h7-8H,5-6H2,1-4H3,(H,9,12);;;;.
What are the key properties of alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane?
alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane has a molecular weight of 272.35 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;hydroxy-(2-methylpropoxy)-(2-methylpropylsulfanyl)-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 175017596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).