C16H35O2PS2 — CID 22062721
2-ethylhexoxy-(2-ethylhexylsulfanyl)-hydroxy-sulfanylidene-λ5-phosphane (PubChem CID 22062721) has the molecular formula C16H35O2PS2 and a molecular weight of 354.56 g/mol. Its IUPAC name is 2-ethylhexoxy-(2-ethylhexylsulfanyl)-hydroxy-sulfanylidene-λ5-phosphane.
| Compound Name | 2-ethylhexoxy-(2-ethylhexylsulfanyl)-hydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 22062721 |
| Molecular Formula | C16H35O2PS2 |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-ethylhexoxy-(2-ethylhexylsulfanyl)-hydroxy-sulfanylidene-λ5-phosphane |
| SMILES | CCCCC(CC)COP(O)(=S)SCC(CC)CCCC |
| InChI | InChI=1S/C16H35O2PS2/c1-5-9-11-15(7-3)13-18-19(17,20)21-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3,(H,17,20) |
| InChIKey | DJYXXTPFVXXNJU-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|