C48H102O6P3S6Sb — CID 164511717
bis[bis(2-ethylhexoxy)phosphinothioylsulfanyl]stibanylsulfanyl-bis(2-ethylhexoxy)-sulfanylidene-λ5-phosphane (PubChem CID 164511717) has the molecular formula C48H102O6P3S6Sb and a molecular weight of 1182.42 g/mol. Its IUPAC name is bis[bis(2-ethylhexoxy)phosphinothioylsulfanyl]stibanylsulfanyl-bis(2-ethylhexoxy)-sulfanylidene-λ5-phosphane.
| Compound Name | bis[bis(2-ethylhexoxy)phosphinothioylsulfanyl]stibanylsulfanyl-bis(2-ethylhexoxy)-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 164511717 |
| Molecular Formula | C48H102O6P3S6Sb |
| Molecular Weight | 1182.42 g/mol |
| Exact Mass | 1180.43 |
| IUPAC Name | bis[bis(2-ethylhexoxy)phosphinothioylsulfanyl]stibanylsulfanyl-bis(2-ethylhexoxy)-sulfanylidene-λ5-phosphane |
| SMILES | CCCCC(CC)COP(=S)(OCC(CC)CCCC)S[Sb](SP(=S)(OCC(CC)CCCC)OCC(CC)CCCC)SP(=S)(OCC(CC)CCCC)OCC(CC)CCCC |
| InChI | InChI=1S/3C16H35O2PS2.Sb/c3*1-5-9-11-15(7-3)13-17-19(20,21)18-14-16(8-4)12-10-6-2;/h3*15-16H,5-14H2,1-4H3,(H,20,21);/q;;;+3/p-3 |
| InChIKey | HWFCBJDGOMEJGH-UHFFFAOYSA-K |
| XLogP | 20.24 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1182.42 |
| LogP ≤ 5 | 20.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|