C23H36F5O2PS2 — CID 102462092
bis(2-ethylhexoxy)-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-sulfanylidene-λ5-phosphane (PubChem CID 102462092) has the molecular formula C23H36F5O2PS2 and a molecular weight of 534.64 g/mol. Its IUPAC name is bis(2-ethylhexoxy)-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-sulfanylidene-λ5-phosphane.
| Compound Name | bis(2-ethylhexoxy)-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 102462092 |
| Molecular Formula | C23H36F5O2PS2 |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | bis(2-ethylhexoxy)-[(2,3,4,5,6-pentafluorophenyl)methylsulfanyl]-sulfanylidene-λ5-phosphane |
| SMILES | CCCCC(CC)COP(=S)(OCC(CC)CCCC)SCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H36F5O2PS2/c1-5-9-11-16(7-3)13-29-31(32,30-14-17(8-4)12-10-6-2)33-15-18-19(24)21(26)23(28)22(27)20(18)25/h16-17H,5-15H2,1-4H3 |
| InChIKey | CJMYYHZVEZGFOU-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|