C16H35O2PS2Sn — CID 54607094
CID 54607094 (PubChem CID 54607094) has the molecular formula C16H35O2PS2Sn and a molecular weight of 473.27 g/mol.
| Compound Name | CID 54607094 |
|---|---|
| PubChem CID | 54607094 |
| Molecular Formula | C16H35O2PS2Sn |
| Molecular Weight | 473.27 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)COP(=S)(S)OCC(CC)CCCC.[Sn] |
| InChI | InChI=1S/C16H35O2PS2.Sn/c1-5-9-11-15(7-3)13-17-19(20,21)18-14-16(8-4)12-10-6-2;/h15-16H,5-14H2,1-4H3,(H,20,21); |
| InChIKey | CABBZQMVEMTDDM-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.27 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|