C24H54O4P2S4 — CID 87604085
dihydroxy-octylsulfanyl-sulfanylidene-λ5-phosphane;2-ethylhexoxy-(2-ethylhexylsulfanyl)-hydroxy-sulfanylidene-λ5-phosphane (PubChem CID 87604085) has the molecular formula C24H54O4P2S4 and a molecular weight of 596.91 g/mol. Its IUPAC name is dihydroxy-octylsulfanyl-sulfanylidene-λ5-phosphane;2-ethylhexoxy-(2-ethylhexylsulfanyl)-hydroxy-sulfanylidene-λ5-phosphane.
| Compound Name | dihydroxy-octylsulfanyl-sulfanylidene-λ5-phosphane;2-ethylhexoxy-(2-ethylhexylsulfanyl)-hydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 87604085 |
| Molecular Formula | C24H54O4P2S4 |
| Molecular Weight | 596.91 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | dihydroxy-octylsulfanyl-sulfanylidene-λ5-phosphane;2-ethylhexoxy-(2-ethylhexylsulfanyl)-hydroxy-sulfanylidene-λ5-phosphane |
| SMILES | CCCCC(CC)COP(O)(=S)SCC(CC)CCCC.CCCCCCCCSP(O)(O)=S |
| InChI | InChI=1S/C16H35O2PS2.C8H19O2PS2/c1-5-9-11-15(7-3)13-18-19(17,20)21-14-16(8-4)12-10-6-2;1-2-3-4-5-6-7-8-13-11(9,10)12/h15-16H,5-14H2,1-4H3,(H,17,20);2-8H2,1H3,(H2,9,10,12) |
| InChIKey | ZEZSWGRYEKEHHB-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.91 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|