C9H20O2PS2- — CID 86195651
3-methylbutoxy-(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane (PubChem CID 86195651) has the molecular formula C9H20O2PS2- and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-methylbutoxy-(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane.
| Compound Name | 3-methylbutoxy-(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane |
|---|---|
| PubChem CID | 86195651 |
| Molecular Formula | C9H20O2PS2- |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 3-methylbutoxy-(2-methylpropoxy)-sulfanylidene-sulfido-λ5-phosphane |
| SMILES | CC(C)CCOP(=S)([S-])OCC(C)C |
| InChI | InChI=1S/C9H21O2PS2/c1-8(2)5-6-10-12(13,14)11-7-9(3)4/h8-9H,5-7H2,1-4H3,(H,13,14)/p-1 |
| InChIKey | UVIOWNXVZLPNRX-UHFFFAOYSA-M |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|