C12H26O2PS2Zn- — CID 160768800
bis(4-methylpentoxy)-sulfanylidene-sulfido-λ5-phosphane;zinc (PubChem CID 160768800) has the molecular formula C12H26O2PS2Zn- and a molecular weight of 362.84 g/mol. Its IUPAC name is bis(4-methylpentoxy)-sulfanylidene-sulfido-λ5-phosphane;zinc.
| Compound Name | bis(4-methylpentoxy)-sulfanylidene-sulfido-λ5-phosphane;zinc |
|---|---|
| PubChem CID | 160768800 |
| Molecular Formula | C12H26O2PS2Zn- |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | bis(4-methylpentoxy)-sulfanylidene-sulfido-λ5-phosphane;zinc |
| SMILES | CC(C)CCCOP(=S)([S-])OCCCC(C)C.[Zn] |
| InChI | InChI=1S/C12H27O2PS2.Zn/c1-11(2)7-5-9-13-15(16,17)14-10-6-8-12(3)4;/h11-12H,5-10H2,1-4H3,(H,16,17);/p-1 |
| InChIKey | PVYGQGZFIBTSAK-UHFFFAOYSA-M |
| XLogP | 4.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|