C12H27O2PS — CID 170936670
hydroxy-(7-methyloctoxy)-propan-2-yl-sulfanylidene-λ5-phosphane (PubChem CID 170936670) has the molecular formula C12H27O2PS and a molecular weight of 266.39 g/mol. Its IUPAC name is hydroxy-(7-methyloctoxy)-propan-2-yl-sulfanylidene-λ5-phosphane.
| Compound Name | hydroxy-(7-methyloctoxy)-propan-2-yl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 170936670 |
| Molecular Formula | C12H27O2PS |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | hydroxy-(7-methyloctoxy)-propan-2-yl-sulfanylidene-λ5-phosphane |
| SMILES | CC(C)CCCCCCOP(O)(=S)C(C)C |
| InChI | InChI=1S/C12H27O2PS/c1-11(2)9-7-5-6-8-10-14-15(13,16)12(3)4/h11-12H,5-10H2,1-4H3,(H,13,16) |
| InChIKey | WYVDFPIOAHAAKW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|