About calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane)
calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane) (PubChem CID 87237721) has the molecular formula C24H52CaO4P2S4
and a molecular weight of 634.97 g/mol. Its IUPAC name is calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane).
Molecular Properties
| Compound Name | calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane) |
| PubChem CID | 87237721 |
| Molecular Formula | C24H52CaO4P2S4 |
| Molecular Weight | 634.97 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane) |
| SMILES | CCCCCCOP(=S)([S-])OCCCCCC.CCCCCCOP(=S)([S-])OCCCCCC.[Ca+2] |
| InChI | InChI=1S/2C12H27O2PS2.Ca/c2*1-3-5-7-9-11-13-15(16,17)14-12-10-8-6-4-2;/h2*3-12H2,1-2H3,(H,16,17);/q;;+2/p-2 |
| InChIKey | SHHFZBVAGAYSTP-UHFFFAOYSA-L |
| XLogP | 9.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.97 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane)?
The IUPAC name of calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane) (CID 87237721) is calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane).
What is the SMILES notation for calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane)?
The canonical SMILES for calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane) is CCCCCCOP(=S)([S-])OCCCCCC.CCCCCCOP(=S)([S-])OCCCCCC.[Ca+2].
What is the InChIKey of calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane)?
The InChIKey is SHHFZBVAGAYSTP-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H27O2PS2.Ca/c2*1-3-5-7-9-11-13-15(16,17)14-12-10-8-6-4-2;/h2*3-12H2,1-2H3,(H,16,17);/q;;+2/p-2.
What are the key properties of calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane)?
calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane) has a molecular weight of 634.97 g/mol, XLogP of 9.52, 24 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(dihexoxy-sulfanylidene-sulfido-λ5-phosphane) is sourced from PubChem (CID 87237721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).