About butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc
butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc (PubChem CID 174854596) has the molecular formula C12H27O2PS2Zn
and a molecular weight of 363.84 g/mol. Its IUPAC name is butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc.
Molecular Properties
| Compound Name | butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc |
| PubChem CID | 174854596 |
| Molecular Formula | C12H27O2PS2Zn |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc |
| SMILES | CCCCCCCCOP(=S)(S)OCCCC.[Zn] |
| InChI | InChI=1S/C12H27O2PS2.Zn/c1-3-5-7-8-9-10-12-14-15(16,17)13-11-6-4-2;/h3-12H2,1-2H3,(H,16,17); |
| InChIKey | NRLFOTKJOYGEJW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc?
The IUPAC name of butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc (CID 174854596) is butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc.
What is the SMILES notation for butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc?
The canonical SMILES for butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc is CCCCCCCCOP(=S)(S)OCCCC.[Zn].
What is the InChIKey of butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc?
The InChIKey is NRLFOTKJOYGEJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27O2PS2.Zn/c1-3-5-7-8-9-10-12-14-15(16,17)13-11-6-4-2;/h3-12H2,1-2H3,(H,16,17);.
What are the key properties of butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc?
butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc has a molecular weight of 363.84 g/mol, XLogP of 5.33, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butoxy-octoxy-sulfanyl-sulfanylidene-λ5-phosphane;zinc is sourced from PubChem (CID 174854596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).