About CID 158562006
CID 158562006 (PubChem CID 158562006) has the molecular formula C16H35NaO2PS2
and a molecular weight of 377.55 g/mol.
Molecular Properties
| Compound Name | CID 158562006 |
| PubChem CID | 158562006 |
| Molecular Formula | C16H35NaO2PS2 |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | — |
| SMILES | CCCCCCCCOP(=S)(S)OCCCCCCCC.[Na] |
| InChI | InChI=1S/C16H35O2PS2.Na/c1-3-5-7-9-11-13-15-17-19(20,21)18-16-14-12-10-8-6-4-2;/h3-16H2,1-2H3,(H,20,21); |
| InChIKey | HQZQXLCAMRQFJO-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 158562006 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158562006?
The IUPAC name of CID 158562006 (CID 158562006) is not available.
What is the SMILES notation for CID 158562006?
The canonical SMILES for CID 158562006 is CCCCCCCCOP(=S)(S)OCCCCCCCC.[Na].
What is the InChIKey of CID 158562006?
The InChIKey is HQZQXLCAMRQFJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35O2PS2.Na/c1-3-5-7-9-11-13-15-17-19(20,21)18-16-14-12-10-8-6-4-2;/h3-16H2,1-2H3,(H,20,21);.
What are the key properties of CID 158562006?
CID 158562006 has a molecular weight of 377.55 g/mol, XLogP of 6.51, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158562006 is sourced from PubChem (CID 158562006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).