About azane;tripentoxy(sulfanylidene)-λ5-phosphane
azane;tripentoxy(sulfanylidene)-λ5-phosphane (PubChem CID 88758051) has the molecular formula C15H36NO3PS
and a molecular weight of 341.50 g/mol. Its IUPAC name is azane;tripentoxy(sulfanylidene)-λ5-phosphane.
Molecular Properties
| Compound Name | azane;tripentoxy(sulfanylidene)-λ5-phosphane |
| PubChem CID | 88758051 |
| Molecular Formula | C15H36NO3PS |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | azane;tripentoxy(sulfanylidene)-λ5-phosphane |
| SMILES | CCCCCOP(=S)(OCCCCC)OCCCCC.N |
| InChI | InChI=1S/C15H33O3PS.H3N/c1-4-7-10-13-16-19(20,17-14-11-8-5-2)18-15-12-9-6-3;/h4-15H2,1-3H3;1H3 |
| InChIKey | RPFWJFUMDKACDX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 62.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;tripentoxy(sulfanylidene)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;tripentoxy(sulfanylidene)-λ5-phosphane?
The IUPAC name of azane;tripentoxy(sulfanylidene)-λ5-phosphane (CID 88758051) is azane;tripentoxy(sulfanylidene)-λ5-phosphane.
What is the SMILES notation for azane;tripentoxy(sulfanylidene)-λ5-phosphane?
The canonical SMILES for azane;tripentoxy(sulfanylidene)-λ5-phosphane is CCCCCOP(=S)(OCCCCC)OCCCCC.N.
What is the InChIKey of azane;tripentoxy(sulfanylidene)-λ5-phosphane?
The InChIKey is RPFWJFUMDKACDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33O3PS.H3N/c1-4-7-10-13-16-19(20,17-14-11-8-5-2)18-15-12-9-6-3;/h4-15H2,1-3H3;1H3.
What are the key properties of azane;tripentoxy(sulfanylidene)-λ5-phosphane?
azane;tripentoxy(sulfanylidene)-λ5-phosphane has a molecular weight of 341.50 g/mol, XLogP of 5.99, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;tripentoxy(sulfanylidene)-λ5-phosphane is sourced from PubChem (CID 88758051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).