potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane

C12H26KO2PS2 — CID 18679

IUPACpotassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane
SMILESCCCCCCOP(=S)([S-])OCCCCCC.[K+]
InChIInChI=1S/C12H27O2PS2.K/c1-3-5-7-9-11-13-15(16,17)14-12-10-8-6-4-2;/h3-12H2,1-2H3,(H,16,17);/q;+1/p-1
InChIKeyRTUCDEDYPIJQDJ-UHFFFAOYSA-M
MW336.54 g/mol
LogP1.96
Rot. Bonds12

About potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane

potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane (PubChem CID 18679) has the molecular formula C12H26KO2PS2 and a molecular weight of 336.54 g/mol. Its IUPAC name is potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane.

Molecular Properties

Compound Namepotassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane
PubChem CID18679
Molecular FormulaC12H26KO2PS2
Molecular Weight336.54 g/mol
Exact Mass336.07
IUPAC Namepotassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane
SMILESCCCCCCOP(=S)([S-])OCCCCCC.[K+]
InChIInChI=1S/C12H27O2PS2.K/c1-3-5-7-9-11-13-15(16,17)14-12-10-8-6-4-2;/h3-12H2,1-2H3,(H,16,17);/q;+1/p-1
InChIKeyRTUCDEDYPIJQDJ-UHFFFAOYSA-M
XLogP1.96
TPSA18.46 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds12
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500336.54
LogP ≤ 51.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}

Analyze potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane?
The IUPAC name of potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane (CID 18679) is potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane.
What is the SMILES notation for potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane?
The canonical SMILES for potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane is CCCCCCOP(=S)([S-])OCCCCCC.[K+].
What is the InChIKey of potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane?
The InChIKey is RTUCDEDYPIJQDJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H27O2PS2.K/c1-3-5-7-9-11-13-15(16,17)14-12-10-8-6-4-2;/h3-12H2,1-2H3,(H,16,17);/q;+1/p-1.
What are the key properties of potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane?
potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane has a molecular weight of 336.54 g/mol, XLogP of 1.96, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium dihexoxy-sulfanylidene-sulfido-lambda5-phosphane is sourced from PubChem (CID 18679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).