C9H17N2O6PS-2 — CID 23420364
tert-butyl N-(1-amino-3-dioxidophosphinothioyloxy-1-oxobutan-2-yl)carbamate (PubChem CID 23420364) has the molecular formula C9H17N2O6PS-2 and a molecular weight of 312.28 g/mol. Its IUPAC name is tert-butyl N-(1-amino-3-dioxidophosphinothioyloxy-1-oxobutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-amino-3-dioxidophosphinothioyloxy-1-oxobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 23420364 |
| Molecular Formula | C9H17N2O6PS-2 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | tert-butyl N-(1-amino-3-dioxidophosphinothioyloxy-1-oxobutan-2-yl)carbamate |
| SMILES | CC(OP([O-])([O-])=S)C(NC(=O)OC(C)(C)C)C(N)=O |
| InChI | InChI=1S/C9H19N2O6PS/c1-5(17-18(14,15)19)6(7(10)12)11-8(13)16-9(2,3)4/h5-6H,1-4H3,(H2,10,12)(H,11,13)(H2,14,15,19)/p-2 |
| InChIKey | QYZLQHVFCBCGAG-UHFFFAOYSA-L |
| XLogP | -1.28 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|