C9H23NO18P4 — CID 10745373
3-aminopropyl [(1R,2R,3R,4R,5R,6S)-2,5-dihydroxy-3,4,6-triphosphonooxycyclohexyl] hydrogen phosphate (PubChem CID 10745373) has the molecular formula C9H23NO18P4 and a molecular weight of 557.17 g/mol. Its IUPAC name is 3-aminopropyl [(1R,2R,3R,4R,5R,6S)-2,5-dihydroxy-3,4,6-triphosphonooxycyclohexyl] hydrogen phosphate.
| Compound Name | 3-aminopropyl [(1R,2R,3R,4R,5R,6S)-2,5-dihydroxy-3,4,6-triphosphonooxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 10745373 |
| Molecular Formula | C9H23NO18P4 |
| Molecular Weight | 557.17 g/mol |
| Exact Mass | 556.99 |
| IUPAC Name | 3-aminopropyl [(1R,2R,3R,4R,5R,6S)-2,5-dihydroxy-3,4,6-triphosphonooxycyclohexyl] hydrogen phosphate |
| SMILES | NCCCOP(=O)(O)O[C@@H]1[C@H](O)[C@@H](OP(=O)(O)O)[C@H](OP(=O)(O)O)[C@@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C9H23NO18P4/c10-2-1-3-24-32(22,23)28-9-5(12)7(26-30(16,17)18)6(25-29(13,14)15)4(11)8(9)27-31(19,20)21/h4-9,11-12H,1-3,10H2,(H,22,23)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)/t4-,5-,6-,7-,8+,9-/m1/s1 |
| InChIKey | IKWSMNGAUMBWBT-QGMREWSDSA-N |
| XLogP | -2.99 |
| TPSA | 322.52 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.17 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|