C13H21O19P3 — CID 146924711
[(2R)-2-oxaldehydoyl-4,5-dioxopentyl] [(2R,5S)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate (PubChem CID 146924711) has the molecular formula C13H21O19P3 and a molecular weight of 574.21 g/mol. Its IUPAC name is [(2R)-2-oxaldehydoyl-4,5-dioxopentyl] [(2R,5S)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate.
| Compound Name | [(2R)-2-oxaldehydoyl-4,5-dioxopentyl] [(2R,5S)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 146924711 |
| Molecular Formula | C13H21O19P3 |
| Molecular Weight | 574.21 g/mol |
| Exact Mass | 573.99 |
| IUPAC Name | [(2R)-2-oxaldehydoyl-4,5-dioxopentyl] [(2R,5S)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate |
| SMILES | O=CC(=O)C[C@H](COP(=O)(O)OC1C(O)[C@@H](OP(=O)(O)O)C(O)C(OP(=O)(O)O)[C@H]1O)C(=O)C=O |
| InChI | InChI=1S/C13H21O19P3/c14-2-6(16)1-5(7(17)3-15)4-29-35(27,28)32-13-9(19)11(30-33(21,22)23)8(18)12(10(13)20)31-34(24,25)26/h2-3,5,8-13,18-20H,1,4H2,(H,27,28)(H2,21,22,23)(H2,24,25,26)/t5-,8?,9-,10?,11?,12+,13?/m1/s1 |
| InChIKey | ADVVECSBKWBWKW-WJPYSKPWSA-N |
| XLogP | -3.92 |
| TPSA | 318.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.21 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|