C8H17O7P — CID 121400591
cis-(1S,4R)-6-dimethylphosphoryloxycyclohexane-1,2,3,4,5-pentol (PubChem CID 121400591) has the molecular formula C8H17O7P and a molecular weight of 256.19 g/mol. Its IUPAC name is cis-(1S,4R)-6-dimethylphosphoryloxycyclohexane-1,2,3,4,5-pentol.
| Compound Name | cis-(1S,4R)-6-dimethylphosphoryloxycyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 121400591 |
| Molecular Formula | C8H17O7P |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | cis-(1S,4R)-6-dimethylphosphoryloxycyclohexane-1,2,3,4,5-pentol |
| SMILES | CP(C)(=O)OC1C(O)[C@H](O)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C8H17O7P/c1-16(2,14)15-8-6(12)4(10)3(9)5(11)7(8)13/h3-13H,1-2H3/t3?,4-,5?,6?,7+,8?/m1/s1 |
| InChIKey | AQUAMCSUCYYMGS-XSHXQCSZSA-N |
| XLogP | -2.27 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|