C6H13O8PS — CID 14860413
(1S,2S,4R,5S)-6-dihydroxyphosphinothioyloxycyclohexane-1,2,3,4,5-pentol (PubChem CID 14860413) has the molecular formula C6H13O8PS and a molecular weight of 276.20 g/mol. Its IUPAC name is (1S,2S,4R,5S)-6-dihydroxyphosphinothioyloxycyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1S,2S,4R,5S)-6-dihydroxyphosphinothioyloxycyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 14860413 |
| Molecular Formula | C6H13O8PS |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | (1S,2S,4R,5S)-6-dihydroxyphosphinothioyloxycyclohexane-1,2,3,4,5-pentol |
| SMILES | OC1[C@@H](O)[C@H](O)C(OP(O)(O)=S)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H13O8PS/c7-1-2(8)4(10)6(5(11)3(1)9)14-15(12,13)16/h1-11H,(H2,12,13,16)/t1?,2-,3+,4-,5-,6?/m0/s1 |
| InChIKey | NMRTXVUJNGNXSX-LXOASSSBSA-N |
| XLogP | -3.60 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|