C34H38FO13P3S — CID 10700517
dibenzyl [(1S,2R,3S,4S,5S,6S)-4-bis(phenylmethoxy)phosphoryloxy-2-dihydroxyphosphinothioyloxy-6-fluoro-3,5-dihydroxycyclohexyl] phosphate (PubChem CID 10700517) has the molecular formula C34H38FO13P3S and a molecular weight of 798.65 g/mol. Its IUPAC name is dibenzyl [(1S,2R,3S,4S,5S,6S)-4-bis(phenylmethoxy)phosphoryloxy-2-dihydroxyphosphinothioyloxy-6-fluoro-3,5-dihydroxycyclohexyl] phosphate.
| Compound Name | dibenzyl [(1S,2R,3S,4S,5S,6S)-4-bis(phenylmethoxy)phosphoryloxy-2-dihydroxyphosphinothioyloxy-6-fluoro-3,5-dihydroxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 10700517 |
| Molecular Formula | C34H38FO13P3S |
| Molecular Weight | 798.65 g/mol |
| Exact Mass | 798.12 |
| IUPAC Name | dibenzyl [(1S,2R,3S,4S,5S,6S)-4-bis(phenylmethoxy)phosphoryloxy-2-dihydroxyphosphinothioyloxy-6-fluoro-3,5-dihydroxycyclohexyl] phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)O[C@@H]1[C@H](O)[C@H](F)[C@@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)[C@H](OP(O)(O)=S)[C@H]1O |
| InChI | InChI=1S/C34H38FO13P3S/c35-29-30(36)33(48-51(41,44-23-27-17-9-3-10-18-27)45-24-28-19-11-4-12-20-28)31(37)34(46-49(38,39)52)32(29)47-50(40,42-21-25-13-5-1-6-14-25)43-22-26-15-7-2-8-16-26/h1-20,29-34,36-37H,21-24H2,(H2,38,39,52)/t29-,30+,31-,32+,33+,34+/m0/s1 |
| InChIKey | MXIZKWOXHKYEDU-NOMPHJLISA-N |
| XLogP | 6.51 |
| TPSA | 179.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|