C48H50O12P2 — CID 10629497
dibenzyl [(1R,2S,3R,4S,5S,6R)-2-bis(phenylmethoxy)phosphoryloxy-4,5-dihydroxy-3,6-bis(phenylmethoxy)cyclohexyl] phosphate (PubChem CID 10629497) has the molecular formula C48H50O12P2 and a molecular weight of 880.86 g/mol. Its IUPAC name is dibenzyl [(1R,2S,3R,4S,5S,6R)-2-bis(phenylmethoxy)phosphoryloxy-4,5-dihydroxy-3,6-bis(phenylmethoxy)cyclohexyl] phosphate.
| Compound Name | dibenzyl [(1R,2S,3R,4S,5S,6R)-2-bis(phenylmethoxy)phosphoryloxy-4,5-dihydroxy-3,6-bis(phenylmethoxy)cyclohexyl] phosphate |
|---|---|
| PubChem CID | 10629497 |
| Molecular Formula | C48H50O12P2 |
| Molecular Weight | 880.86 g/mol |
| Exact Mass | 880.28 |
| IUPAC Name | dibenzyl [(1R,2S,3R,4S,5S,6R)-2-bis(phenylmethoxy)phosphoryloxy-4,5-dihydroxy-3,6-bis(phenylmethoxy)cyclohexyl] phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)O[C@@H]1[C@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](O)[C@H](O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C48H50O12P2/c49-43-44(50)46(54-32-38-21-9-2-10-22-38)48(60-62(52,57-35-41-27-15-5-16-28-41)58-36-42-29-17-6-18-30-42)47(45(43)53-31-37-19-7-1-8-20-37)59-61(51,55-33-39-23-11-3-12-24-39)56-34-40-25-13-4-14-26-40/h1-30,43-50H,31-36H2/t43-,44-,45+,46+,47-,48+/m0/s1 |
| InChIKey | QFIUZRAOUVFZRW-VTMSEVDRSA-N |
| XLogP | 9.75 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.86 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|