C3H9O12P3 — CID 90829097
1,3-dioxolan-2-yl [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 90829097) has the molecular formula C3H9O12P3 and a molecular weight of 330.02 g/mol. Its IUPAC name is 1,3-dioxolan-2-yl [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | 1,3-dioxolan-2-yl [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 90829097 |
| Molecular Formula | C3H9O12P3 |
| Molecular Weight | 330.02 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | 1,3-dioxolan-2-yl [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC1OCCO1 |
| InChI | InChI=1S/C3H9O12P3/c4-16(5,6)14-18(9,10)15-17(7,8)13-3-11-1-2-12-3/h3H,1-2H2,(H,7,8)(H,9,10)(H2,4,5,6) |
| InChIKey | SKVJZYYXRYIWLI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.02 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|