C15H31N2O12P — CID 67907563
[(1S,2R,3S,4R,5R,6S)-2-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3,4,5,6-tetrahydroxycyclohexyl] (2S)-2,6-diaminohexanoate (PubChem CID 67907563) has the molecular formula C15H31N2O12P and a molecular weight of 462.39 g/mol. Its IUPAC name is [(1S,2R,3S,4R,5R,6S)-2-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3,4,5,6-tetrahydroxycyclohexyl] (2S)-2,6-diaminohexanoate.
| Compound Name | [(1S,2R,3S,4R,5R,6S)-2-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3,4,5,6-tetrahydroxycyclohexyl] (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 67907563 |
| Molecular Formula | C15H31N2O12P |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | [(1S,2R,3S,4R,5R,6S)-2-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3,4,5,6-tetrahydroxycyclohexyl] (2S)-2,6-diaminohexanoate |
| SMILES | NCCCC[C@H](N)C(=O)O[C@H]1C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1OP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C15H31N2O12P/c16-4-2-1-3-8(17)15(24)28-13-11(22)9(20)10(21)12(23)14(13)29-30(25,26)27-6-7(19)5-18/h7-14,18-23H,1-6,16-17H2,(H,25,26)/t7?,8-,9+,10+,11?,12-,13-,14+/m0/s1 |
| InChIKey | GDPITTYJECEHMB-NVHZSMALSA-N |
| XLogP | -4.33 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | -4.33 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|