C9H21NO11P+ — CID 140689894
[[(2S)-2,3-dihydroxypropoxy]-[(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxyazanium (PubChem CID 140689894) has the molecular formula C9H21NO11P+ and a molecular weight of 350.24 g/mol. Its IUPAC name is [[(2S)-2,3-dihydroxypropoxy]-[(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxyazanium.
| Compound Name | [[(2S)-2,3-dihydroxypropoxy]-[(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxyazanium |
|---|---|
| PubChem CID | 140689894 |
| Molecular Formula | C9H21NO11P+ |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | [[(2S)-2,3-dihydroxypropoxy]-[(2R,3S,5R,6R)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphoryl]oxyazanium |
| SMILES | [NH3+]OP(=O)(OC[C@@H](O)CO)OC1[C@H](O)C(O)C(O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H21NO11P/c10-21-22(18,19-2-3(12)1-11)20-9-7(16)5(14)4(13)6(15)8(9)17/h3-9,11-17H,1-2H2,10H3/q+1/t3-,4?,5+,6?,7+,8+,9?,22?/m0/s1 |
| InChIKey | UGHXBZDOTKLFMV-GLTUGJEHSA-N |
| XLogP | -5.16 |
| TPSA | 214.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|