C39H79O8P — CID 162680185
[(4S,8S,12S,16S,20S)-4,8,12,16,20-pentamethylheptacosyl] [(1R,2S,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl] hydrogen phosphate (PubChem CID 162680185) has the molecular formula C39H79O8P and a molecular weight of 707.03 g/mol. Its IUPAC name is [(4S,8S,12S,16S,20S)-4,8,12,16,20-pentamethylheptacosyl] [(1R,2S,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl] hydrogen phosphate.
| Compound Name | [(4S,8S,12S,16S,20S)-4,8,12,16,20-pentamethylheptacosyl] [(1R,2S,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 162680185 |
| Molecular Formula | C39H79O8P |
| Molecular Weight | 707.03 g/mol |
| Exact Mass | 706.55 |
| IUPAC Name | [(4S,8S,12S,16S,20S)-4,8,12,16,20-pentamethylheptacosyl] [(1R,2S,3S,4R,5R)-2,3,4-trihydroxy-5-(hydroxymethyl)cyclohexyl] hydrogen phosphate |
| SMILES | CCCCCCC[C@H](C)CCC[C@H](C)CCC[C@H](C)CCC[C@H](C)CCC[C@H](C)CCCOP(=O)(O)O[C@@H]1C[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C39H79O8P/c1-7-8-9-10-11-17-30(2)18-12-19-31(3)20-13-21-32(4)22-14-23-33(5)24-15-25-34(6)26-16-27-46-48(44,45)47-36-28-35(29-40)37(41)39(43)38(36)42/h30-43H,7-29H2,1-6H3,(H,44,45)/t30-,31-,32-,33-,34-,35+,36+,37+,38+,39-/m0/s1 |
| InChIKey | IWZOWMVCZCJZJF-ZTZKFORPSA-N |
| XLogP | 9.59 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.03 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|