C9H21NO14P4 — CID 87089279
3-aminopropyl [2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-5-phosphanyloxolan-3-yl] carbonate (PubChem CID 87089279) has the molecular formula C9H21NO14P4 and a molecular weight of 491.16 g/mol. Its IUPAC name is 3-aminopropyl [2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-5-phosphanyloxolan-3-yl] carbonate.
| Compound Name | 3-aminopropyl [2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-5-phosphanyloxolan-3-yl] carbonate |
|---|---|
| PubChem CID | 87089279 |
| Molecular Formula | C9H21NO14P4 |
| Molecular Weight | 491.16 g/mol |
| Exact Mass | 490.99 |
| IUPAC Name | 3-aminopropyl [2-[[hydroxy-[hydroxy(phosphonooxy)phosphoryl]oxyphosphoryl]oxymethyl]-5-phosphanyloxolan-3-yl] carbonate |
| SMILES | NCCCOC(=O)OC1CC(P)OC1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C9H21NO14P4/c10-2-1-3-19-9(11)22-6-4-8(25)21-7(6)5-20-27(15,16)24-28(17,18)23-26(12,13)14/h6-8H,1-5,10,25H2,(H,15,16)(H,17,18)(H2,12,13,14) |
| InChIKey | MHYIYSINKWTGKC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 230.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.16 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|