C9H19N2O13P3 — CID 163597996
[[(2R,5R)-5-acetamido-3-[(methylideneamino)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 163597996) has the molecular formula C9H19N2O13P3 and a molecular weight of 456.17 g/mol. Its IUPAC name is [[(2R,5R)-5-acetamido-3-[(methylideneamino)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-5-acetamido-3-[(methylideneamino)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 163597996 |
| Molecular Formula | C9H19N2O13P3 |
| Molecular Weight | 456.17 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | [[(2R,5R)-5-acetamido-3-[(methylideneamino)methoxy]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=NCOC1C[C@H](NC(C)=O)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C9H19N2O13P3/c1-6(12)11-9-3-7(20-5-10-2)8(22-9)4-21-26(16,17)24-27(18,19)23-25(13,14)15/h7-9H,2-5H2,1H3,(H,11,12)(H,16,17)(H,18,19)(H2,13,14,15)/t7?,8-,9-/m1/s1 |
| InChIKey | GVDLZQOAYYWDGY-CFCGPWAMSA-N |
| XLogP | -0.38 |
| TPSA | 219.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.17 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|